C16H13F3N4 — CID 137425102
2-methyl-4-[8-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-yl]aniline (PubChem CID 137425102) has the molecular formula C16H13F3N4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-methyl-4-[8-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-yl]aniline.
| Compound Name | 2-methyl-4-[8-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 137425102 |
| Molecular Formula | C16H13F3N4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-methyl-4-[8-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-yl]aniline |
| SMILES | Cc1cc(-c2ncc3nc(C(F)(F)F)cc(C)c3n2)ccc1N |
| InChI | InChI=1S/C16H13F3N4/c1-8-5-10(3-4-11(8)20)15-21-7-12-14(23-15)9(2)6-13(22-12)16(17,18)19/h3-7H,20H2,1-2H3 |
| InChIKey | YYKFLSOSVIFDIT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|