C16H12F3N3 — CID 137425224
2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]aniline (PubChem CID 137425224) has the molecular formula C16H12F3N3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]aniline.
| Compound Name | 2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]aniline |
|---|---|
| PubChem CID | 137425224 |
| Molecular Formula | C16H12F3N3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]aniline |
| SMILES | Cc1cc(-c2ncc3cc(C(F)(F)F)ccc3n2)ccc1N |
| InChI | InChI=1S/C16H12F3N3/c1-9-6-10(2-4-13(9)20)15-21-8-11-7-12(16(17,18)19)3-5-14(11)22-15/h2-8H,20H2,1H3 |
| InChIKey | NURZTTAQSQUUHI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|