C20H14F3N5O — CID 137434662
N-[2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 137434662) has the molecular formula C20H14F3N5O and a molecular weight of 397.36 g/mol. Its IUPAC name is N-[2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 137434662 |
| Molecular Formula | C20H14F3N5O |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[2-methyl-4-[6-(trifluoromethyl)quinazolin-2-yl]phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cc(-c2ncc3cc(C(F)(F)F)ccc3n2)ccc1NC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C20H14F3N5O/c1-11-8-12(2-4-15(11)27-19(29)17-6-7-25-28-17)18-24-10-13-9-14(20(21,22)23)3-5-16(13)26-18/h2-10H,1H3,(H,25,28)(H,27,29) |
| InChIKey | WTNVCQMOINWCSF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |