C20H22N4O2 — CID 137425551
2-(ethylamino)-2-(4-methoxyphenyl)-N-[4-(1H-pyrazol-4-yl)phenyl]acetamide (PubChem CID 137425551) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(ethylamino)-2-(4-methoxyphenyl)-N-[4-(1H-pyrazol-4-yl)phenyl]acetamide.
| Compound Name | 2-(ethylamino)-2-(4-methoxyphenyl)-N-[4-(1H-pyrazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 137425551 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(ethylamino)-2-(4-methoxyphenyl)-N-[4-(1H-pyrazol-4-yl)phenyl]acetamide |
| SMILES | CCNC(C(=O)Nc1ccc(-c2cn[nH]c2)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-3-21-19(15-6-10-18(26-2)11-7-15)20(25)24-17-8-4-14(5-9-17)16-12-22-23-13-16/h4-13,19,21H,3H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | CJQJNHRONARDRB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |