C19H20N4O3 — CID 71654828
1-[(2,4-dimethoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]urea (PubChem CID 71654828) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]urea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 71654828 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc(-c3cn[nH]c3)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-25-17-8-5-14(18(9-17)26-2)10-20-19(24)23-16-6-3-13(4-7-16)15-11-21-22-12-15/h3-9,11-12H,10H2,1-2H3,(H,21,22)(H2,20,23,24) |
| InChIKey | IEBMZSUHFMKXJW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |