C12H14N4O3 — CID 47338634
N-[(2,4-dimethoxyphenyl)methyl]-2H-triazole-4-carboxamide (PubChem CID 47338634) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 47338634 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2H-triazole-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cn[nH]n2)c(OC)c1 |
| InChI | InChI=1S/C12H14N4O3/c1-18-9-4-3-8(11(5-9)19-2)6-13-12(17)10-7-14-16-15-10/h3-5,7H,6H2,1-2H3,(H,13,17)(H,14,15,16) |
| InChIKey | FDCDUJUVDXFMDU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |