C15H17N3O3 — CID 81235643
4-amino-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 81235643) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-amino-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 4-amino-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81235643 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-amino-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cnccc2N)c(OC)c1 |
| InChI | InChI=1S/C15H17N3O3/c1-20-11-4-3-10(14(7-11)21-2)8-18-15(19)12-9-17-6-5-13(12)16/h3-7,9H,8H2,1-2H3,(H2,16,17)(H,18,19) |
| InChIKey | GFZXFDRJYSEFCB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |