C17H21N3O3 — CID 77094958
N-[(2,4-dimethoxyphenyl)methyl]-4-propylpyrimidine-5-carboxamide (PubChem CID 77094958) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-propylpyrimidine-5-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-propylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 77094958 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-propylpyrimidine-5-carboxamide |
| SMILES | CCCc1ncncc1C(=O)NCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H21N3O3/c1-4-5-15-14(10-18-11-20-15)17(21)19-9-12-6-7-13(22-2)8-16(12)23-3/h6-8,10-11H,4-5,9H2,1-3H3,(H,19,21) |
| InChIKey | GWHRIXJHPLLPTQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |