C11H18FN — CID 137427520
8-fluoro-2,4-dimethylcyclooctane-1-carbonitrile (PubChem CID 137427520) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is 8-fluoro-2,4-dimethylcyclooctane-1-carbonitrile.
| Compound Name | 8-fluoro-2,4-dimethylcyclooctane-1-carbonitrile |
|---|---|
| PubChem CID | 137427520 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 8-fluoro-2,4-dimethylcyclooctane-1-carbonitrile |
| SMILES | CC1CCCC(F)C(C#N)C(C)C1 |
| InChI | InChI=1S/C11H18FN/c1-8-4-3-5-11(12)10(7-13)9(2)6-8/h8-11H,3-6H2,1-2H3 |
| InChIKey | BABCLIVTXYIYPX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |