About 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile
2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile (PubChem CID 146499291) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile.
Molecular Properties
| Compound Name | 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile |
| PubChem CID | 146499291 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile |
| SMILES | CC1CC(C)CC(C#N)C(F)C1 |
| InChI | InChI=1S/C10H16FN/c1-7-3-8(2)5-10(11)9(4-7)6-12/h7-10H,3-5H2,1-2H3 |
| InChIKey | KKZVQHLLYOEFQY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile?
The IUPAC name of 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile (CID 146499291) is 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile.
What is the SMILES notation for 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile?
The canonical SMILES for 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile is CC1CC(C)CC(C#N)C(F)C1.
What is the InChIKey of 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile?
The InChIKey is KKZVQHLLYOEFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FN/c1-7-3-8(2)5-10(11)9(4-7)6-12/h7-10H,3-5H2,1-2H3.
What are the key properties of 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile?
2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile has a molecular weight of 169.24 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,6-dimethylcycloheptane-1-carbonitrile is sourced from PubChem (CID 146499291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).