About 2-ethyl-N'-methylbut-3-enimidamide
2-ethyl-N'-methylbut-3-enimidamide (PubChem CID 137428073) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethyl-N'-methylbut-3-enimidamide.
Molecular Properties
| Compound Name | 2-ethyl-N'-methylbut-3-enimidamide |
| PubChem CID | 137428073 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-ethyl-N'-methylbut-3-enimidamide |
| SMILES | C=CC(CC)/C(N)=N/C |
| InChI | InChI=1S/C7H14N2/c1-4-6(5-2)7(8)9-3/h4,6H,1,5H2,2-3H3,(H2,8,9) |
| InChIKey | XSMIJOLGPWVGTC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N'-methylbut-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N'-methylbut-3-enimidamide?
The IUPAC name of 2-ethyl-N'-methylbut-3-enimidamide (CID 137428073) is 2-ethyl-N'-methylbut-3-enimidamide.
What is the SMILES notation for 2-ethyl-N'-methylbut-3-enimidamide?
The canonical SMILES for 2-ethyl-N'-methylbut-3-enimidamide is C=CC(CC)/C(N)=N/C.
What is the InChIKey of 2-ethyl-N'-methylbut-3-enimidamide?
The InChIKey is XSMIJOLGPWVGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-4-6(5-2)7(8)9-3/h4,6H,1,5H2,2-3H3,(H2,8,9).
What are the key properties of 2-ethyl-N'-methylbut-3-enimidamide?
2-ethyl-N'-methylbut-3-enimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N'-methylbut-3-enimidamide is sourced from PubChem (CID 137428073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).