C8H15N3 — CID 146182622
N-(1-aminoethylidene)-N',2-dimethylbut-3-enimidamide (PubChem CID 146182622) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-(1-aminoethylidene)-N',2-dimethylbut-3-enimidamide.
| Compound Name | N-(1-aminoethylidene)-N',2-dimethylbut-3-enimidamide |
|---|---|
| PubChem CID | 146182622 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-(1-aminoethylidene)-N',2-dimethylbut-3-enimidamide |
| SMILES | C=CC(C)C(=N/C)/N=C(\C)N |
| InChI | InChI=1S/C8H15N3/c1-5-6(2)8(10-4)11-7(3)9/h5-6H,1H2,2-4H3,(H2,9,10,11) |
| InChIKey | LCFGDUVAKFEOOO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|