About (E)-4-fluoro-N'-methylbut-3-enimidamide
(E)-4-fluoro-N'-methylbut-3-enimidamide (PubChem CID 142083566) has the molecular formula C5H9FN2
and a molecular weight of 116.14 g/mol. Its IUPAC name is (E)-4-fluoro-N'-methylbut-3-enimidamide.
Molecular Properties
| Compound Name | (E)-4-fluoro-N'-methylbut-3-enimidamide |
| PubChem CID | 142083566 |
| Molecular Formula | C5H9FN2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | (E)-4-fluoro-N'-methylbut-3-enimidamide |
| SMILES | C/N=C(\N)C/C=C/F |
| InChI | InChI=1S/C5H9FN2/c1-8-5(7)3-2-4-6/h2,4H,3H2,1H3,(H2,7,8)/b4-2+ |
| InChIKey | CICIUMSGLCOYIE-DUXPYHPUSA-N |
| XLogP | 0.85 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-fluoro-N'-methylbut-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-fluoro-N'-methylbut-3-enimidamide?
The IUPAC name of (E)-4-fluoro-N'-methylbut-3-enimidamide (CID 142083566) is (E)-4-fluoro-N'-methylbut-3-enimidamide.
What is the SMILES notation for (E)-4-fluoro-N'-methylbut-3-enimidamide?
The canonical SMILES for (E)-4-fluoro-N'-methylbut-3-enimidamide is C/N=C(\N)C/C=C/F.
What is the InChIKey of (E)-4-fluoro-N'-methylbut-3-enimidamide?
The InChIKey is CICIUMSGLCOYIE-DUXPYHPUSA-N. The full InChI is InChI=1S/C5H9FN2/c1-8-5(7)3-2-4-6/h2,4H,3H2,1H3,(H2,7,8)/b4-2+.
What are the key properties of (E)-4-fluoro-N'-methylbut-3-enimidamide?
(E)-4-fluoro-N'-methylbut-3-enimidamide has a molecular weight of 116.14 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-fluoro-N'-methylbut-3-enimidamide is sourced from PubChem (CID 142083566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).