C18H23N3O4 — CID 137428190
tert-butyl 2-[2-(2-hydroxyethyl)indazole-3-carbonyl]azetidine-1-carboxylate (PubChem CID 137428190) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-hydroxyethyl)indazole-3-carbonyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(2-hydroxyethyl)indazole-3-carbonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 137428190 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl 2-[2-(2-hydroxyethyl)indazole-3-carbonyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC1C(=O)c1c2ccccc2nn1CCO |
| InChI | InChI=1S/C18H23N3O4/c1-18(2,3)25-17(24)20-9-8-14(20)16(23)15-12-6-4-5-7-13(12)19-21(15)10-11-22/h4-7,14,22H,8-11H2,1-3H3 |
| InChIKey | NUHZBWMSSMPOOY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |