C17H27N — CID 137429120
1,4,4-trimethyl-3-(2-methylbutyl)-2,3-dihydroquinoline (PubChem CID 137429120) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1,4,4-trimethyl-3-(2-methylbutyl)-2,3-dihydroquinoline.
| Compound Name | 1,4,4-trimethyl-3-(2-methylbutyl)-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 137429120 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1,4,4-trimethyl-3-(2-methylbutyl)-2,3-dihydroquinoline |
| SMILES | CCC(C)CC1CN(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H27N/c1-6-13(2)11-14-12-18(5)16-10-8-7-9-15(16)17(14,3)4/h7-10,13-14H,6,11-12H2,1-5H3 |
| InChIKey | VDKRQDIIAHQQCA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |