C22H28N2O4 — CID 137429800
methyl (2E,4Z)-6-[[1-(2-methoxyphenyl)cyclopentyl]methylamino]-2-methyl-5-(methylideneamino)-6-oxohexa-2,4-dienoate (PubChem CID 137429800) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl (2E,4Z)-6-[[1-(2-methoxyphenyl)cyclopentyl]methylamino]-2-methyl-5-(methylideneamino)-6-oxohexa-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-6-[[1-(2-methoxyphenyl)cyclopentyl]methylamino]-2-methyl-5-(methylideneamino)-6-oxohexa-2,4-dienoate |
|---|---|
| PubChem CID | 137429800 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (2E,4Z)-6-[[1-(2-methoxyphenyl)cyclopentyl]methylamino]-2-methyl-5-(methylideneamino)-6-oxohexa-2,4-dienoate |
| SMILES | C=N/C(=C\C=C(/C)C(=O)OC)C(=O)NCC1(c2ccccc2OC)CCCC1 |
| InChI | InChI=1S/C22H28N2O4/c1-16(21(26)28-4)11-12-18(23-2)20(25)24-15-22(13-7-8-14-22)17-9-5-6-10-19(17)27-3/h5-6,9-12H,2,7-8,13-15H2,1,3-4H3,(H,24,25)/b16-11+,18-12- |
| InChIKey | XZCJORGLJXOVBK-JASSCNTNSA-N |
| XLogP | 3.33 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|