C13H17N3S — CID 137431964
N-cyclobutyl-2-ethyl-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 137431964) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N-cyclobutyl-2-ethyl-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclobutyl-2-ethyl-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137431964 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-cyclobutyl-2-ethyl-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1nc(NC2CCC2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C13H17N3S/c1-3-11-15-12(14-9-5-4-6-9)10-7-8(2)17-13(10)16-11/h7,9H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | TZCZNXPWTAXMGR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |