C36H26N4 — CID 137433549
2-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4,6-dinaphthalen-2-ylpyrimidine (PubChem CID 137433549) has the molecular formula C36H26N4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4,6-dinaphthalen-2-ylpyrimidine.
| Compound Name | 2-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4,6-dinaphthalen-2-ylpyrimidine |
|---|---|
| PubChem CID | 137433549 |
| Molecular Formula | C36H26N4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4,6-dinaphthalen-2-ylpyrimidine |
| SMILES | Cc1cc(C)nc(-c2ccc(-c3nc(-c4ccc5ccccc5c4)cc(-c4ccc5ccccc5c4)n3)cc2)n1 |
| InChI | InChI=1S/C36H26N4/c1-23-19-24(2)38-35(37-23)27-13-15-28(16-14-27)36-39-33(31-17-11-25-7-3-5-9-29(25)20-31)22-34(40-36)32-18-12-26-8-4-6-10-30(26)21-32/h3-22H,1-2H3 |
| InChIKey | YZVRZMBEFBSQJZ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |