C14H8ClF4N3O — CID 137434224
5-[2-chloro-8-fluoro-4-methyl-6-(trifluoromethyl)quinolin-3-yl]-3-methyl-1,2,4-oxadiazole (PubChem CID 137434224) has the molecular formula C14H8ClF4N3O and a molecular weight of 345.68 g/mol. Its IUPAC name is 5-[2-chloro-8-fluoro-4-methyl-6-(trifluoromethyl)quinolin-3-yl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[2-chloro-8-fluoro-4-methyl-6-(trifluoromethyl)quinolin-3-yl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 137434224 |
| Molecular Formula | C14H8ClF4N3O |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 5-[2-chloro-8-fluoro-4-methyl-6-(trifluoromethyl)quinolin-3-yl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(-c2c(Cl)nc3c(F)cc(C(F)(F)F)cc3c2C)n1 |
| InChI | InChI=1S/C14H8ClF4N3O/c1-5-8-3-7(14(17,18)19)4-9(16)11(8)21-12(15)10(5)13-20-6(2)22-23-13/h3-4H,1-2H3 |
| InChIKey | PDOJZOGPATVHNV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|