C15H12ClF2N3O — CID 137434506
5-(2-chloro-6-ethyl-7,8-difluoro-4-methylquinolin-3-yl)-3-methyl-1,2,4-oxadiazole (PubChem CID 137434506) has the molecular formula C15H12ClF2N3O and a molecular weight of 323.73 g/mol. Its IUPAC name is 5-(2-chloro-6-ethyl-7,8-difluoro-4-methylquinolin-3-yl)-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-(2-chloro-6-ethyl-7,8-difluoro-4-methylquinolin-3-yl)-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 137434506 |
| Molecular Formula | C15H12ClF2N3O |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 5-(2-chloro-6-ethyl-7,8-difluoro-4-methylquinolin-3-yl)-3-methyl-1,2,4-oxadiazole |
| SMILES | CCc1cc2c(C)c(-c3nc(C)no3)c(Cl)nc2c(F)c1F |
| InChI | InChI=1S/C15H12ClF2N3O/c1-4-8-5-9-6(2)10(15-19-7(3)21-22-15)14(16)20-13(9)12(18)11(8)17/h5H,4H2,1-3H3 |
| InChIKey | FKZGMISMAMIATL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|