C10H10F3NO — CID 137434412
1-[2-amino-5-(2,2,2-trifluoroethyl)phenyl]ethanone (PubChem CID 137434412) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 1-[2-amino-5-(2,2,2-trifluoroethyl)phenyl]ethanone.
| Compound Name | 1-[2-amino-5-(2,2,2-trifluoroethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 137434412 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-[2-amino-5-(2,2,2-trifluoroethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(CC(F)(F)F)ccc1N |
| InChI | InChI=1S/C10H10F3NO/c1-6(15)8-4-7(2-3-9(8)14)5-10(11,12)13/h2-4H,5,14H2,1H3 |
| InChIKey | ZBFRLLRTFLNTKQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|