C11H12LiNO3 — CID 58481210
lithium 3-(3-acetyl-4-aminophenyl)propanoate (PubChem CID 58481210) has the molecular formula C11H12LiNO3 and a molecular weight of 213.16 g/mol. Its IUPAC name is lithium 3-(3-acetyl-4-aminophenyl)propanoate.
| Compound Name | lithium 3-(3-acetyl-4-aminophenyl)propanoate |
|---|---|
| PubChem CID | 58481210 |
| Molecular Formula | C11H12LiNO3 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | lithium 3-(3-acetyl-4-aminophenyl)propanoate |
| SMILES | CC(=O)c1cc(CCC(=O)[O-])ccc1N.[Li+] |
| InChI | InChI=1S/C11H13NO3.Li/c1-7(13)9-6-8(2-4-10(9)12)3-5-11(14)15;/h2,4,6H,3,5,12H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | DLZGPMJJINKNPX-UHFFFAOYSA-M |
| XLogP | -2.84 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|