C21H21N5O5S — CID 137435087
2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]-N-(2-methoxyethyl)acetamide (PubChem CID 137435087) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 137435087 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ccc(-c2nnc(Nc3nc4c(OC)cccc4s3)o2)cc1 |
| InChI | InChI=1S/C21H21N5O5S/c1-28-11-10-22-17(27)12-30-14-8-6-13(7-9-14)19-25-26-20(31-19)24-21-23-18-15(29-2)4-3-5-16(18)32-21/h3-9H,10-12H2,1-2H3,(H,22,27)(H,23,24,26) |
| InChIKey | DCZFVYRHDITXMJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|