C25H21N5O4S — CID 137425209
N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]benzamide (PubChem CID 137425209) has the molecular formula C25H21N5O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]benzamide.
| Compound Name | N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 137425209 |
| Molecular Formula | C25H21N5O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]benzamide |
| SMILES | COc1cccc2sc(Nc3nnc(-c4ccc(OCCNC(=O)c5ccccc5)cc4)o3)nc12 |
| InChI | InChI=1S/C25H21N5O4S/c1-32-19-8-5-9-20-21(19)27-25(35-20)28-24-30-29-23(34-24)17-10-12-18(13-11-17)33-15-14-26-22(31)16-6-3-2-4-7-16/h2-13H,14-15H2,1H3,(H,26,31)(H,27,28,30) |
| InChIKey | VSQSIECPLQAKJD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|