C20H19N5O4S — CID 137424728
N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]acetamide (PubChem CID 137424728) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]acetamide.
| Compound Name | N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 137424728 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[2-[4-[5-[(4-methoxy-1,3-benzothiazol-2-yl)amino]-1,3,4-oxadiazol-2-yl]phenoxy]ethyl]acetamide |
| SMILES | COc1cccc2sc(Nc3nnc(-c4ccc(OCCNC(C)=O)cc4)o3)nc12 |
| InChI | InChI=1S/C20H19N5O4S/c1-12(26)21-10-11-28-14-8-6-13(7-9-14)18-24-25-19(29-18)23-20-22-17-15(27-2)4-3-5-16(17)30-20/h3-9H,10-11H2,1-2H3,(H,21,26)(H,22,23,25) |
| InChIKey | FAEWPFLQKAKNER-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|