C21H21N3O17 — CID 137436145
[3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 137436145) has the molecular formula C21H21N3O17 and a molecular weight of 587.40 g/mol. Its IUPAC name is [3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 137436145 |
| Molecular Formula | C21H21N3O17 |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | [3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(OCC1OCC(OC(=O)ON2C(=O)CCC2=O)C(O)C1OC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H21N3O17/c25-11-1-2-12(26)22(11)39-19(32)36-8-10-18(38-21(34)41-24-15(29)5-6-16(24)30)17(31)9(7-35-10)37-20(33)40-23-13(27)3-4-14(23)28/h9-10,17-18,31H,1-8H2 |
| InChIKey | OTIVIXYCYARPOE-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 248.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|