C24H29N3O17 — CID 155040882
[3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2-ethyl-5-oxopyrrolidin-1-yl) carbonate (PubChem CID 155040882) has the molecular formula C24H29N3O17 and a molecular weight of 631.50 g/mol. Its IUPAC name is [3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2-ethyl-5-oxopyrrolidin-1-yl) carbonate.
| Compound Name | [3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2-ethyl-5-oxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 155040882 |
| Molecular Formula | C24H29N3O17 |
| Molecular Weight | 631.50 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | [3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2-ethyl-5-oxopyrrolidin-1-yl) carbonate |
| SMILES | CCC1CCC(=O)N1OC(=O)OCC1OC(OC)C(OC(=O)ON2C(=O)CCC2=O)C(O)C1OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H29N3O17/c1-3-11-4-5-13(28)25(11)42-22(34)38-10-12-19(40-23(35)43-26-14(29)6-7-15(26)30)18(33)20(21(37-2)39-12)41-24(36)44-27-16(31)8-9-17(27)32/h11-12,18-21,33H,3-10H2,1-2H3 |
| InChIKey | OICUTCVKOPUAJI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 240.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.50 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|