C25H34N2O2 — CID 137436293
(3S,5S)-5-(ethoxymethyl)-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide (PubChem CID 137436293) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (3S,5S)-5-(ethoxymethyl)-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide.
| Compound Name | (3S,5S)-5-(ethoxymethyl)-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide |
|---|---|
| PubChem CID | 137436293 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (3S,5S)-5-(ethoxymethyl)-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide |
| SMILES | CCOC[C@@]12CC3CC4(C(=O)N[C@H]5CCN[C@H](C)C5)C[C@](c5ccccc5)(C1)C342 |
| InChI | InChI=1S/C25H34N2O2/c1-3-29-16-22-12-19-13-23(21(28)27-20-9-10-26-17(2)11-20)15-24(14-22,25(19,22)23)18-7-5-4-6-8-18/h4-8,17,19-20,26H,3,9-16H2,1-2H3,(H,27,28)/t17-,19?,20+,22-,23?,24+,25?/m1/s1 |
| InChIKey | YRFVKZZSGUNGLJ-VAOFEGFCSA-N |
| XLogP | 3.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |