C26H36N2O — CID 137436215
(3S,5R)-5-ethyl-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide (PubChem CID 137436215) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is (3S,5R)-5-ethyl-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide.
| Compound Name | (3S,5R)-5-ethyl-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide |
|---|---|
| PubChem CID | 137436215 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (3S,5R)-5-ethyl-N-[(2R,4S)-2-methylpiperidin-4-yl]-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide |
| SMILES | CC[C@]12CC3CC4(C(=O)N[C@H]5CCN[C@H](C)C5)CC1(C3)[C@](c1ccccc1)(C4)C2 |
| InChI | InChI=1S/C26H36N2O/c1-3-24-13-19-12-23(22(29)28-21-9-10-27-18(2)11-21)15-25(17-24,26(24,14-19)16-23)20-7-5-4-6-8-20/h4-8,18-19,21,27H,3,9-17H2,1-2H3,(H,28,29)/t18-,19?,21+,23?,24-,25-,26?/m1/s1 |
| InChIKey | TWDGLXHRKMLJRM-SFSMFZCSSA-N |
| XLogP | 4.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |