C10H13BrO2 — CID 137440943
(4R)-4-[(1S,2S)-2-(2-bromoethynyl)cyclopropyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 137440943) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is (4R)-4-[(1S,2S)-2-(2-bromoethynyl)cyclopropyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1S,2S)-2-(2-bromoethynyl)cyclopropyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 137440943 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | (4R)-4-[(1S,2S)-2-(2-bromoethynyl)cyclopropyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H]([C@H]2C[C@@H]2C#CBr)O1 |
| InChI | InChI=1S/C10H13BrO2/c1-10(2)12-6-9(13-10)8-5-7(8)3-4-11/h7-9H,5-6H2,1-2H3/t7-,8-,9-/m0/s1 |
| InChIKey | MWSIBWGPKPRCNR-CIUDSAMLSA-N |
| XLogP | 2.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|