C13H28N2 — CID 137442786
2-methyl-1,2-di(propan-2-yl)cyclohexane-1,3-diamine (PubChem CID 137442786) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-methyl-1,2-di(propan-2-yl)cyclohexane-1,3-diamine.
| Compound Name | 2-methyl-1,2-di(propan-2-yl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 137442786 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2-methyl-1,2-di(propan-2-yl)cyclohexane-1,3-diamine |
| SMILES | CC(C)C1(N)CCCC(N)C1(C)C(C)C |
| InChI | InChI=1S/C13H28N2/c1-9(2)12(5)11(14)7-6-8-13(12,15)10(3)4/h9-11H,6-8,14-15H2,1-5H3 |
| InChIKey | VOCXRKILKMHYDS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |