C21H30N2O2 — CID 137443562
tert-butyl 2-[2,6-di(propan-2-yl)-4-pyrazol-1-ylphenyl]acetate (PubChem CID 137443562) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is tert-butyl 2-[2,6-di(propan-2-yl)-4-pyrazol-1-ylphenyl]acetate.
| Compound Name | tert-butyl 2-[2,6-di(propan-2-yl)-4-pyrazol-1-ylphenyl]acetate |
|---|---|
| PubChem CID | 137443562 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl 2-[2,6-di(propan-2-yl)-4-pyrazol-1-ylphenyl]acetate |
| SMILES | CC(C)c1cc(-n2cccn2)cc(C(C)C)c1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30N2O2/c1-14(2)17-11-16(23-10-8-9-22-23)12-18(15(3)4)19(17)13-20(24)25-21(5,6)7/h8-12,14-15H,13H2,1-7H3 |
| InChIKey | BVNQQZFUUACWEW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |