C16H19N5O2 — CID 54233451
tert-butyl N-[[5-(cyanoamino)-2-pyrazol-1-ylphenyl]methyl]carbamate (PubChem CID 54233451) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is tert-butyl N-[[5-(cyanoamino)-2-pyrazol-1-ylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(cyanoamino)-2-pyrazol-1-ylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 54233451 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl N-[[5-(cyanoamino)-2-pyrazol-1-ylphenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(NC#N)ccc1-n1cccn1 |
| InChI | InChI=1S/C16H19N5O2/c1-16(2,3)23-15(22)18-10-12-9-13(19-11-17)5-6-14(12)21-8-4-7-20-21/h4-9,19H,10H2,1-3H3,(H,18,22) |
| InChIKey | QKWUANMLPWCMRU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|