C25H42N2O8 — CID 137444882
[(3R,4S)-2-methyl-4-(3-methylbutoxy)pentan-3-yl] (2S)-2-[[3-(ethoxymethoxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate (PubChem CID 137444882) has the molecular formula C25H42N2O8 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(3R,4S)-2-methyl-4-(3-methylbutoxy)pentan-3-yl] (2S)-2-[[3-(ethoxymethoxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate.
| Compound Name | [(3R,4S)-2-methyl-4-(3-methylbutoxy)pentan-3-yl] (2S)-2-[[3-(ethoxymethoxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 137444882 |
| Molecular Formula | C25H42N2O8 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | [(3R,4S)-2-methyl-4-(3-methylbutoxy)pentan-3-yl] (2S)-2-[[3-(ethoxymethoxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate |
| SMILES | CCOCOCOc1c(OC)ccnc1C(=O)N[C@@H](C)C(=O)O[C@H](C(C)C)[C@H](C)OCCC(C)C |
| InChI | InChI=1S/C25H42N2O8/c1-9-31-14-32-15-34-23-20(30-8)10-12-26-21(23)24(28)27-18(6)25(29)35-22(17(4)5)19(7)33-13-11-16(2)3/h10,12,16-19,22H,9,11,13-15H2,1-8H3,(H,27,28)/t18-,19-,22+/m0/s1 |
| InChIKey | FMVPYGSTLBRUKN-CNNODRBYSA-N |
| XLogP | 3.57 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|