C22H34N2O7 — CID 137444952
[(2S)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate (PubChem CID 137444952) has the molecular formula C22H34N2O7 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(2S)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate.
| Compound Name | [(2S)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 137444952 |
| Molecular Formula | C22H34N2O7 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(2S)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
| SMILES | CCCCO[C@@H](C)C(OC(=O)[C@H](C)NC(=O)c1nccc(OC)c1OC(C)=O)C(C)C |
| InChI | InChI=1S/C22H34N2O7/c1-8-9-12-29-15(5)19(13(2)3)31-22(27)14(4)24-21(26)18-20(30-16(6)25)17(28-7)10-11-23-18/h10-11,13-15,19H,8-9,12H2,1-7H3,(H,24,26)/t14-,15-,19?/m0/s1 |
| InChIKey | DTTSQZDSZWUVEG-YIYRCGFGSA-N |
| XLogP | 2.91 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|