C24H30N2O7 — CID 137446050
4-[4-[3-[[2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]butan-2-yl]phenoxy]butanoic acid (PubChem CID 137446050) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is 4-[4-[3-[[2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]butan-2-yl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[3-[[2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]butan-2-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 137446050 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 4-[4-[3-[[2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]butan-2-yl]phenoxy]butanoic acid |
| SMILES | CC(NCC(O)c1cc(O)cc2c1OCC(=O)N2)C(C)c1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H30N2O7/c1-14(16-5-7-18(8-6-16)32-9-3-4-23(30)31)15(2)25-12-21(28)19-10-17(27)11-20-24(19)33-13-22(29)26-20/h5-8,10-11,14-15,21,25,27-28H,3-4,9,12-13H2,1-2H3,(H,26,29)(H,30,31) |
| InChIKey | BOZHIXLTJIGFOB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|