C24H27F2N2O8+ — CID 69497287
(E)-but-2-enedioic acid;2-(3,5-difluorophenyl)ethyl-[(2R)-2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]-dimethylazanium (PubChem CID 69497287) has the molecular formula C24H27F2N2O8+ and a molecular weight of 509.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(3,5-difluorophenyl)ethyl-[(2R)-2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]-dimethylazanium.
| Compound Name | (E)-but-2-enedioic acid;2-(3,5-difluorophenyl)ethyl-[(2R)-2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 69497287 |
| Molecular Formula | C24H27F2N2O8+ |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(3,5-difluorophenyl)ethyl-[(2R)-2-hydroxy-2-(6-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCc1cc(F)cc(F)c1)C[C@H](O)c1cc(O)cc2c1OCC(=O)N2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H22F2N2O4.C4H4O4/c1-24(2,4-3-12-5-13(21)7-14(22)6-12)10-18(26)16-8-15(25)9-17-20(16)28-11-19(27)23-17;5-3(6)1-2-4(7)8/h5-9,18,26H,3-4,10-11H2,1-2H3,(H-,23,25,27);1-2H,(H,5,6)(H,7,8)/p+1/b;2-1+/t18-;/m0./s1 |
| InChIKey | LGQVIEJJZDUHPB-GCQRLXCUSA-O |
| XLogP | 2.07 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|