C23H30NO5- — CID 160512996
carbanide;6-hydroxy-8-[1-hydroxy-5-(4-methoxyphenyl)-4,4-dimethylpentyl]-4H-1,4-benzoxazin-3-one (PubChem CID 160512996) has the molecular formula C23H30NO5- and a molecular weight of 400.50 g/mol. Its IUPAC name is carbanide;6-hydroxy-8-[1-hydroxy-5-(4-methoxyphenyl)-4,4-dimethylpentyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | carbanide;6-hydroxy-8-[1-hydroxy-5-(4-methoxyphenyl)-4,4-dimethylpentyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 160512996 |
| Molecular Formula | C23H30NO5- |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | carbanide;6-hydroxy-8-[1-hydroxy-5-(4-methoxyphenyl)-4,4-dimethylpentyl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(CC(C)(C)CCC(O)c2cc(O)cc3c2OCC(=O)N3)cc1.[CH3-] |
| InChI | InChI=1S/C22H27NO5.CH3/c1-22(2,12-14-4-6-16(27-3)7-5-14)9-8-19(25)17-10-15(24)11-18-21(17)28-13-20(26)23-18;/h4-7,10-11,19,24-25H,8-9,12-13H2,1-3H3,(H,23,26);1H3/q;-1 |
| InChIKey | QTHCDKWIGNYAES-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|