C30H42N3O4+ — CID 135138913
8-[2-[[1-[4-[3-(1-azoniabicyclo[2.2.2]octan-1-yl)propoxy]phenyl]-2-methylpropan-2-yl]amino]ethyl]-6-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 135138913) has the molecular formula C30H42N3O4+ and a molecular weight of 508.68 g/mol. Its IUPAC name is 8-[2-[[1-[4-[3-(1-azoniabicyclo[2.2.2]octan-1-yl)propoxy]phenyl]-2-methylpropan-2-yl]amino]ethyl]-6-hydroxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[2-[[1-[4-[3-(1-azoniabicyclo[2.2.2]octan-1-yl)propoxy]phenyl]-2-methylpropan-2-yl]amino]ethyl]-6-hydroxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135138913 |
| Molecular Formula | C30H42N3O4+ |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 8-[2-[[1-[4-[3-(1-azoniabicyclo[2.2.2]octan-1-yl)propoxy]phenyl]-2-methylpropan-2-yl]amino]ethyl]-6-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(Cc1ccc(OCCC[N+]23CCC(CC2)CC3)cc1)NCCc1cc(O)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C30H41N3O4/c1-30(2,31-12-8-24-18-25(34)19-27-29(24)37-21-28(35)32-27)20-23-4-6-26(7-5-23)36-17-3-13-33-14-9-22(10-15-33)11-16-33/h4-7,18-19,22,31H,3,8-17,20-21H2,1-2H3,(H-,32,34,35)/p+1 |
| InChIKey | LEJXZGSXPZOLRB-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|