C23H30N2O2S — CID 134331664
7-[2-[[1-(4-butoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-3H-1,3-benzothiazol-2-one (PubChem CID 134331664) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 7-[2-[[1-(4-butoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2-[[1-(4-butoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 134331664 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 7-[2-[[1-(4-butoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-3H-1,3-benzothiazol-2-one |
| SMILES | CCCCOc1ccc(CC(C)(C)NCCc2cccc3[nH]c(=O)sc23)cc1 |
| InChI | InChI=1S/C23H30N2O2S/c1-4-5-15-27-19-11-9-17(10-12-19)16-23(2,3)24-14-13-18-7-6-8-20-21(18)28-22(26)25-20/h6-12,24H,4-5,13-16H2,1-3H3,(H,25,26) |
| InChIKey | ZIMJSFOSDLEDQP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|