C6H4F6O2 — CID 137451351
4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroethyl)butanal (PubChem CID 137451351) has the molecular formula C6H4F6O2 and a molecular weight of 222.08 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroethyl)butanal.
| Compound Name | 4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroethyl)butanal |
|---|---|
| PubChem CID | 137451351 |
| Molecular Formula | C6H4F6O2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroethyl)butanal |
| SMILES | O=CC(CC(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H4F6O2/c7-5(8,9)1-3(2-13)4(14)6(10,11)12/h2-3H,1H2 |
| InChIKey | ILLQRSWUCZLUFE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|