C18H18F5N5O2 — CID 137452622
(6R)-5-N-(3,4-difluorophenyl)-6-methyl-3-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide (PubChem CID 137452622) has the molecular formula C18H18F5N5O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is (6R)-5-N-(3,4-difluorophenyl)-6-methyl-3-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide.
| Compound Name | (6R)-5-N-(3,4-difluorophenyl)-6-methyl-3-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 137452622 |
| Molecular Formula | C18H18F5N5O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (6R)-5-N-(3,4-difluorophenyl)-6-methyl-3-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
| SMILES | C[C@@H]1Cn2ncc(C(=O)N[C@H](C)C(F)(F)F)c2CN1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F5N5O2/c1-9-7-28-15(12(6-24-28)16(29)25-10(2)18(21,22)23)8-27(9)17(30)26-11-3-4-13(19)14(20)5-11/h3-6,9-10H,7-8H2,1-2H3,(H,25,29)(H,26,30)/t9-,10-/m1/s1 |
| InChIKey | TUHMIUVLRGJYCU-NXEZZACHSA-N |
| XLogP | 3.28 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |