C17H17F5N6O2 — CID 137452738
(6R)-7-N-(2,6-difluoro-4-pyridinyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide (PubChem CID 137452738) has the molecular formula C17H17F5N6O2 and a molecular weight of 432.35 g/mol. Its IUPAC name is (6R)-7-N-(2,6-difluoro-4-pyridinyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide.
| Compound Name | (6R)-7-N-(2,6-difluoro-4-pyridinyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
|---|---|
| PubChem CID | 137452738 |
| Molecular Formula | C17H17F5N6O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (6R)-7-N-(2,6-difluoro-4-pyridinyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
| SMILES | C[C@@H]1Cn2cnc(C(=O)N[C@H](C)C(F)(F)F)c2CN1C(=O)Nc1cc(F)nc(F)c1 |
| InChI | InChI=1S/C17H17F5N6O2/c1-8-5-27-7-23-14(15(29)24-9(2)17(20,21)22)11(27)6-28(8)16(30)25-10-3-12(18)26-13(19)4-10/h3-4,7-9H,5-6H2,1-2H3,(H,24,29)(H,25,26,30)/t8-,9-/m1/s1 |
| InChIKey | MVCLQHLBEYLALP-RKDXNWHRSA-N |
| XLogP | 2.67 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|