C18H20FN3OS — CID 137453703
N-[(5-ethyl-3-methylbenzimidazol-4-yl)methyl]-5-(1-fluoroethyl)thiophene-3-carboxamide (PubChem CID 137453703) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[(5-ethyl-3-methylbenzimidazol-4-yl)methyl]-5-(1-fluoroethyl)thiophene-3-carboxamide.
| Compound Name | N-[(5-ethyl-3-methylbenzimidazol-4-yl)methyl]-5-(1-fluoroethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 137453703 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[(5-ethyl-3-methylbenzimidazol-4-yl)methyl]-5-(1-fluoroethyl)thiophene-3-carboxamide |
| SMILES | CCc1ccc2ncn(C)c2c1CNC(=O)c1csc(C(C)F)c1 |
| InChI | InChI=1S/C18H20FN3OS/c1-4-12-5-6-15-17(22(3)10-21-15)14(12)8-20-18(23)13-7-16(11(2)19)24-9-13/h5-7,9-11H,4,8H2,1-3H3,(H,20,23) |
| InChIKey | TYFGHRWESTUOIP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |