C20H20FN3O4 — CID 137453963
2-[4-(cyclopropylmethyl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 137453963) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethyl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-[4-(cyclopropylmethyl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 137453963 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[4-(cyclopropylmethyl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1C2CCCN2C(=O)N1c1cc2c(cc1F)OC1(CC1)C(=O)N2CC1CC1 |
| InChI | InChI=1S/C20H20FN3O4/c21-12-8-16-15(23(10-11-3-4-11)18(26)20(28-16)5-6-20)9-14(12)24-17(25)13-2-1-7-22(13)19(24)27/h8-9,11,13H,1-7,10H2 |
| InChIKey | IKHUUABARQROIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|