C26H26N4O6 — CID 137456577
1-N,4-N-bis(2-phenoxypropanoyl)benzene-1,4-dicarbohydrazide (PubChem CID 137456577) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is 1-N,4-N-bis(2-phenoxypropanoyl)benzene-1,4-dicarbohydrazide.
| Compound Name | 1-N,4-N-bis(2-phenoxypropanoyl)benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 137456577 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1-N,4-N-bis(2-phenoxypropanoyl)benzene-1,4-dicarbohydrazide |
| SMILES | CC(Oc1ccccc1)C(=O)N(N)C(=O)c1ccc(C(=O)N(N)C(=O)C(C)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N4O6/c1-17(35-21-9-5-3-6-10-21)23(31)29(27)25(33)19-13-15-20(16-14-19)26(34)30(28)24(32)18(2)36-22-11-7-4-8-12-22/h3-18H,27-28H2,1-2H3 |
| InChIKey | TWAPHPKNHXQBAA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|