C17H24N4O3 — CID 137457508
tert-butyl N-[1-[(3R)-1-(2-cyanoethyl)pyrrolidin-3-yl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 137457508) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[1-[(3R)-1-(2-cyanoethyl)pyrrolidin-3-yl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[1-[(3R)-1-(2-cyanoethyl)pyrrolidin-3-yl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137457508 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | tert-butyl N-[1-[(3R)-1-(2-cyanoethyl)pyrrolidin-3-yl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccn([C@@H]2CCN(CCC#N)C2)c1=O |
| InChI | InChI=1S/C17H24N4O3/c1-17(2,3)24-16(23)19-14-6-4-10-21(15(14)22)13-7-11-20(12-13)9-5-8-18/h4,6,10,13H,5,7,9,11-12H2,1-3H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | UPCUDYLIBHZOAT-CYBMUJFWSA-N |
| XLogP | 2.36 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |