C18H27NO — CID 137459177
1-[3-ethyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azepan-1-yl]ethanone (PubChem CID 137459177) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[3-ethyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azepan-1-yl]ethanone.
| Compound Name | 1-[3-ethyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 137459177 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[3-ethyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azepan-1-yl]ethanone |
| SMILES | C=C/C=C\C(=C/C=C)C1(CC)CCCCN(C(C)=O)C1 |
| InChI | InChI=1S/C18H27NO/c1-5-8-12-17(11-6-2)18(7-3)13-9-10-14-19(15-18)16(4)20/h5-6,8,11-12H,1-2,7,9-10,13-15H2,3-4H3/b12-8-,17-11+ |
| InChIKey | VFOQKAJOGRVYLD-JLBVGMENSA-N |
| XLogP | 4.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|