C18H16FN3O — CID 137463725
5-fluoro-3-phenyl-2-[(2S)-pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 137463725) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is 5-fluoro-3-phenyl-2-[(2S)-pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 5-fluoro-3-phenyl-2-[(2S)-pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 137463725 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 5-fluoro-3-phenyl-2-[(2S)-pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | O=c1c2c(F)cccc2nc([C@@H]2CCCN2)n1-c1ccccc1 |
| InChI | InChI=1S/C18H16FN3O/c19-13-8-4-9-14-16(13)18(23)22(12-6-2-1-3-7-12)17(21-14)15-10-5-11-20-15/h1-4,6-9,15,20H,5,10-11H2/t15-/m0/s1 |
| InChIKey | XFWMRGYEGNGALL-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |