C15H12FN3O2 — CID 144894826
2-[amino(hydroxy)methyl]-5-fluoro-3-phenylquinazolin-4-one (PubChem CID 144894826) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-[amino(hydroxy)methyl]-5-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[amino(hydroxy)methyl]-5-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 144894826 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[amino(hydroxy)methyl]-5-fluoro-3-phenylquinazolin-4-one |
| SMILES | NC(O)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C15H12FN3O2/c16-10-7-4-8-11-12(10)15(21)19(14(18-11)13(17)20)9-5-2-1-3-6-9/h1-8,13,20H,17H2 |
| InChIKey | BWZLRFTVJGVBEW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|